C17H28BrN3OS — CID 111623106
1-[(5-bromothiophen-2-yl)methyl]-3-[(2-tert-butyloxan-3-yl)methyl]-2-methylguanidine (PubChem CID 111623106) has the molecular formula C17H28BrN3OS and a molecular weight of 402.40 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-3-[(2-tert-butyloxan-3-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-3-[(2-tert-butyloxan-3-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111623106 |
| Molecular Formula | C17H28BrN3OS |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-3-[(2-tert-butyloxan-3-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc(Br)s1)NCC1CCCOC1C(C)(C)C |
| InChI | InChI=1S/C17H28BrN3OS/c1-17(2,3)15-12(6-5-9-22-15)10-20-16(19-4)21-11-13-7-8-14(18)23-13/h7-8,12,15H,5-6,9-11H2,1-4H3,(H2,19,20,21) |
| InChIKey | DBWOTSVCCVADDD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|