C21H36FIN4O — CID 111623671
1-[(2-tert-butyloxan-3-yl)methyl]-3-[[4-(dimethylamino)-3-fluorophenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111623671) has the molecular formula C21H36FIN4O and a molecular weight of 506.45 g/mol. Its IUPAC name is 1-[(2-tert-butyloxan-3-yl)methyl]-3-[[4-(dimethylamino)-3-fluorophenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2-tert-butyloxan-3-yl)methyl]-3-[[4-(dimethylamino)-3-fluorophenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111623671 |
| Molecular Formula | C21H36FIN4O |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 1-[(2-tert-butyloxan-3-yl)methyl]-3-[[4-(dimethylamino)-3-fluorophenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(N(C)C)c(F)c1)NCC1CCCOC1C(C)(C)C.I |
| InChI | InChI=1S/C21H35FN4O.HI/c1-21(2,3)19-16(8-7-11-27-19)14-25-20(23-4)24-13-15-9-10-18(26(5)6)17(22)12-15;/h9-10,12,16,19H,7-8,11,13-14H2,1-6H3,(H2,23,24,25);1H |
| InChIKey | XSLLJJGNXHOKIS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|