C23H38N4O3 — CID 111623980
N-[3-[2-[[N'-[(2-tert-butyloxan-3-yl)methyl]-N-ethylcarbamimidoyl]amino]ethoxy]phenyl]acetamide (PubChem CID 111623980) has the molecular formula C23H38N4O3 and a molecular weight of 418.58 g/mol. Its IUPAC name is N-[3-[2-[[N'-[(2-tert-butyloxan-3-yl)methyl]-N-ethylcarbamimidoyl]amino]ethoxy]phenyl]acetamide.
| Compound Name | N-[3-[2-[[N'-[(2-tert-butyloxan-3-yl)methyl]-N-ethylcarbamimidoyl]amino]ethoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 111623980 |
| Molecular Formula | C23H38N4O3 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | N-[3-[2-[[N'-[(2-tert-butyloxan-3-yl)methyl]-N-ethylcarbamimidoyl]amino]ethoxy]phenyl]acetamide |
| SMILES | CCN/C(=N\CC1CCCOC1C(C)(C)C)NCCOc1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C23H38N4O3/c1-6-24-22(26-16-18-9-8-13-30-21(18)23(3,4)5)25-12-14-29-20-11-7-10-19(15-20)27-17(2)28/h7,10-11,15,18,21H,6,8-9,12-14,16H2,1-5H3,(H,27,28)(H2,24,25,26) |
| InChIKey | CESVQVBKYMFDLA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|