C17H19NO4 — CID 11162409
ethyl (10S,14R)-12,12-dimethyl-11,13-dioxa-1-azatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-8-carboxylate (PubChem CID 11162409) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is ethyl (10S,14R)-12,12-dimethyl-11,13-dioxa-1-azatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-8-carboxylate.
| Compound Name | ethyl (10S,14R)-12,12-dimethyl-11,13-dioxa-1-azatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-8-carboxylate |
|---|---|
| PubChem CID | 11162409 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | ethyl (10S,14R)-12,12-dimethyl-11,13-dioxa-1-azatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-8-carboxylate |
| SMILES | CCOC(=O)c1c2n(c3ccccc13)C[C@H]1OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C17H19NO4/c1-4-20-16(19)13-10-7-5-6-8-11(10)18-9-12-15(14(13)18)22-17(2,3)21-12/h5-8,12,15H,4,9H2,1-3H3/t12-,15-/m1/s1 |
| InChIKey | LMWKIYGKTRHBLV-IUODEOHRSA-N |
| XLogP | 3.02 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |