C23H41IN4O2 — CID 111624599
1-[(2-tert-butyloxan-3-yl)methyl]-2-methyl-3-[2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide (PubChem CID 111624599) has the molecular formula C23H41IN4O2 and a molecular weight of 532.51 g/mol. Its IUPAC name is 1-[(2-tert-butyloxan-3-yl)methyl]-2-methyl-3-[2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-tert-butyloxan-3-yl)methyl]-2-methyl-3-[2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111624599 |
| Molecular Formula | C23H41IN4O2 |
| Molecular Weight | 532.51 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 1-[(2-tert-butyloxan-3-yl)methyl]-2-methyl-3-[2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1CCCOC1C(C)(C)C)NCC(c1ccc(C)o1)N1CCCC1.I |
| InChI | InChI=1S/C23H40N4O2.HI/c1-17-10-11-20(29-17)19(27-12-6-7-13-27)16-26-22(24-5)25-15-18-9-8-14-28-21(18)23(2,3)4;/h10-11,18-19,21H,6-9,12-16H2,1-5H3,(H2,24,25,26);1H |
| InChIKey | GZKCFLJNAMXKOY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|