C13H21NO7 — CID 11162473
1-O-tert-butyl 2-O,4-O-dimethyl (2S)-5-hydroxypyrrolidine-1,2,4-tricarboxylate (PubChem CID 11162473) has the molecular formula C13H21NO7 and a molecular weight of 303.31 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O,4-O-dimethyl (2S)-5-hydroxypyrrolidine-1,2,4-tricarboxylate.
| Compound Name | 1-O-tert-butyl 2-O,4-O-dimethyl (2S)-5-hydroxypyrrolidine-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 11162473 |
| Molecular Formula | C13H21NO7 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 1-O-tert-butyl 2-O,4-O-dimethyl (2S)-5-hydroxypyrrolidine-1,2,4-tricarboxylate |
| SMILES | COC(=O)C1C[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)C1O |
| InChI | InChI=1S/C13H21NO7/c1-13(2,3)21-12(18)14-8(11(17)20-5)6-7(9(14)15)10(16)19-4/h7-9,15H,6H2,1-5H3/t7?,8-,9?/m0/s1 |
| InChIKey | PTWLIKHIBHPQMT-MGURRDGZSA-N |
| XLogP | 0.28 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|