C25H33FN4O — CID 111625118
1-ethyl-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 111625118) has the molecular formula C25H33FN4O and a molecular weight of 424.56 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111625118 |
| Molecular Formula | C25H33FN4O |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 1-ethyl-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(CN2CCCC2=O)c1)NCC(C)(C)c1cccc(F)c1 |
| InChI | InChI=1S/C25H33FN4O/c1-4-27-24(29-18-25(2,3)21-10-6-11-22(26)15-21)28-16-19-8-5-9-20(14-19)17-30-13-7-12-23(30)31/h5-6,8-11,14-15H,4,7,12-13,16-18H2,1-3H3,(H2,27,28,29) |
| InChIKey | UNBHGTBDYGZONP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|