C20H35IN4OS — CID 111626121
N,N-diethyl-4-[[[ethylamino-(4-methylsulfanylbutylamino)methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111626121) has the molecular formula C20H35IN4OS and a molecular weight of 506.50 g/mol. Its IUPAC name is N,N-diethyl-4-[[[ethylamino-(4-methylsulfanylbutylamino)methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N,N-diethyl-4-[[[ethylamino-(4-methylsulfanylbutylamino)methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111626121 |
| Molecular Formula | C20H35IN4OS |
| Molecular Weight | 506.50 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | N,N-diethyl-4-[[[ethylamino-(4-methylsulfanylbutylamino)methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(CC)CC)cc1)NCCCCSC.I |
| InChI | InChI=1S/C20H34N4OS.HI/c1-5-21-20(22-14-8-9-15-26-4)23-16-17-10-12-18(13-11-17)19(25)24(6-2)7-3;/h10-13H,5-9,14-16H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | OMUARWIKGVJTEI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|