C18H28O4 — CID 11162628
3-(4-cyclohexylbutanoyl)-5-(2-methylpropyl)oxolane-2,4-dione (PubChem CID 11162628) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 3-(4-cyclohexylbutanoyl)-5-(2-methylpropyl)oxolane-2,4-dione.
| Compound Name | 3-(4-cyclohexylbutanoyl)-5-(2-methylpropyl)oxolane-2,4-dione |
|---|---|
| PubChem CID | 11162628 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 3-(4-cyclohexylbutanoyl)-5-(2-methylpropyl)oxolane-2,4-dione |
| SMILES | CC(C)CC1OC(=O)C(C(=O)CCCC2CCCCC2)C1=O |
| InChI | InChI=1S/C18H28O4/c1-12(2)11-15-17(20)16(18(21)22-15)14(19)10-6-9-13-7-4-3-5-8-13/h12-13,15-16H,3-11H2,1-2H3 |
| InChIKey | NMRBQEPBHWHGSS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|