C19H32O3 — CID 11162631
(E,7R)-7-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]tridec-5-en-8-yn-7-ol (PubChem CID 11162631) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is (E,7R)-7-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]tridec-5-en-8-yn-7-ol.
| Compound Name | (E,7R)-7-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]tridec-5-en-8-yn-7-ol |
|---|---|
| PubChem CID | 11162631 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | (E,7R)-7-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]tridec-5-en-8-yn-7-ol |
| SMILES | CCCCC#C[C@](O)(/C=C/CCCC)[C@@H]1CCOC(C)(C)O1 |
| InChI | InChI=1S/C19H32O3/c1-5-7-9-11-14-19(20,15-12-10-8-6-2)17-13-16-21-18(3,4)22-17/h11,14,17,20H,5-10,13,16H2,1-4H3/b14-11+/t17-,19+/m0/s1 |
| InChIKey | QDKFTXGUQCNEKO-ZCMXQVGASA-N |
| XLogP | 4.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|