C15H11N5O3 — CID 11162647
6-amino-2-(4-hydroxyphenyl)-5H-[1,2,4]triazolo[4,3-a]quinoxaline-1,4-dione (PubChem CID 11162647) has the molecular formula C15H11N5O3 and a molecular weight of 309.29 g/mol. Its IUPAC name is 6-amino-2-(4-hydroxyphenyl)-5H-[1,2,4]triazolo[4,3-a]quinoxaline-1,4-dione.
| Compound Name | 6-amino-2-(4-hydroxyphenyl)-5H-[1,2,4]triazolo[4,3-a]quinoxaline-1,4-dione |
|---|---|
| PubChem CID | 11162647 |
| Molecular Formula | C15H11N5O3 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 6-amino-2-(4-hydroxyphenyl)-5H-[1,2,4]triazolo[4,3-a]quinoxaline-1,4-dione |
| SMILES | Nc1cccc2c1[nH]c(=O)c1nn(-c3ccc(O)cc3)c(=O)n12 |
| InChI | InChI=1S/C15H11N5O3/c16-10-2-1-3-11-12(10)17-14(22)13-18-20(15(23)19(11)13)8-4-6-9(21)7-5-8/h1-7,21H,16H2,(H,17,22) |
| InChIKey | KZMCSOWJVPFFRV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|