C19H18O4 — CID 11162677
(6S,6aR,10aS)-2-hydroxy-6-(4-hydroxyphenyl)-6,6a,7,8,10,10a-hexahydrobenzo[c]chromen-9-one (PubChem CID 11162677) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is (6S,6aR,10aS)-2-hydroxy-6-(4-hydroxyphenyl)-6,6a,7,8,10,10a-hexahydrobenzo[c]chromen-9-one.
| Compound Name | (6S,6aR,10aS)-2-hydroxy-6-(4-hydroxyphenyl)-6,6a,7,8,10,10a-hexahydrobenzo[c]chromen-9-one |
|---|---|
| PubChem CID | 11162677 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (6S,6aR,10aS)-2-hydroxy-6-(4-hydroxyphenyl)-6,6a,7,8,10,10a-hexahydrobenzo[c]chromen-9-one |
| SMILES | O=C1CC[C@@H]2[C@H](C1)c1cc(O)ccc1O[C@@H]2c1ccc(O)cc1 |
| InChI | InChI=1S/C19H18O4/c20-12-3-1-11(2-4-12)19-15-7-5-13(21)9-16(15)17-10-14(22)6-8-18(17)23-19/h1-4,6,8,10,15-16,19-20,22H,5,7,9H2/t15-,16+,19-/m1/s1 |
| InChIKey | ZHCLSBXFNCMUQE-JTDSTZFVSA-N |
| XLogP | 3.68 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |