C20H22O3 — CID 11162686
(1R,12R)-1,12-dimethyl-5-propan-2-yl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5,9(16)-tetraene-8,11-dione (PubChem CID 11162686) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is (1R,12R)-1,12-dimethyl-5-propan-2-yl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5,9(16)-tetraene-8,11-dione.
| Compound Name | (1R,12R)-1,12-dimethyl-5-propan-2-yl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5,9(16)-tetraene-8,11-dione |
|---|---|
| PubChem CID | 11162686 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (1R,12R)-1,12-dimethyl-5-propan-2-yl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5,9(16)-tetraene-8,11-dione |
| SMILES | CC(C)c1ccc2c(c1)C(=O)C1=C3[C@@](C)(CCC[C@@]32C)C(=O)O1 |
| InChI | InChI=1S/C20H22O3/c1-11(2)12-6-7-14-13(10-12)15(21)16-17-19(14,3)8-5-9-20(17,4)18(22)23-16/h6-7,10-11H,5,8-9H2,1-4H3/t19-,20-/m1/s1 |
| InChIKey | UKOKENMLXFNPEJ-WOJBJXKFSA-N |
| XLogP | 4.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |