C18H31IN4OS — CID 111628297
N-[4-[2-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]phenyl]acetamide;hydroiodide (PubChem CID 111628297) has the molecular formula C18H31IN4OS and a molecular weight of 478.44 g/mol. Its IUPAC name is N-[4-[2-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]phenyl]acetamide;hydroiodide.
| Compound Name | N-[4-[2-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111628297 |
| Molecular Formula | C18H31IN4OS |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | N-[4-[2-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]phenyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCSC)NCCc1ccc(NC(C)=O)cc1.I |
| InChI | InChI=1S/C18H30N4OS.HI/c1-4-19-18(20-12-5-6-14-24-3)21-13-11-16-7-9-17(10-8-16)22-15(2)23;/h7-10H,4-6,11-14H2,1-3H3,(H,22,23)(H2,19,20,21);1H |
| InChIKey | IARGEEURFDXXMF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|