C15H25NO6 — CID 11162845
ethyl (3aS,5R,6R,7R,7aS)-6-hydroxy-2-oxo-7-pentan-3-yloxy-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazole-5-carboxylate (PubChem CID 11162845) has the molecular formula C15H25NO6 and a molecular weight of 315.37 g/mol. Its IUPAC name is ethyl (3aS,5R,6R,7R,7aS)-6-hydroxy-2-oxo-7-pentan-3-yloxy-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazole-5-carboxylate.
| Compound Name | ethyl (3aS,5R,6R,7R,7aS)-6-hydroxy-2-oxo-7-pentan-3-yloxy-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 11162845 |
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | ethyl (3aS,5R,6R,7R,7aS)-6-hydroxy-2-oxo-7-pentan-3-yloxy-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazole-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H]2NC(=O)O[C@@H]2[C@H](OC(CC)CC)[C@@H]1O |
| InChI | InChI=1S/C15H25NO6/c1-4-8(5-2)21-13-11(17)9(14(18)20-6-3)7-10-12(13)22-15(19)16-10/h8-13,17H,4-7H2,1-3H3,(H,16,19)/t9-,10+,11-,12+,13-/m1/s1 |
| InChIKey | UJZVOFWXXMYEQJ-RXGFPQBGSA-N |
| XLogP | 0.98 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |