C16H14BrNO — CID 11162864
(4S)-8-bromo-2-methyl-4-phenyl-1,4-dihydroisoquinolin-3-one (PubChem CID 11162864) has the molecular formula C16H14BrNO and a molecular weight of 316.20 g/mol. Its IUPAC name is (4S)-8-bromo-2-methyl-4-phenyl-1,4-dihydroisoquinolin-3-one.
| Compound Name | (4S)-8-bromo-2-methyl-4-phenyl-1,4-dihydroisoquinolin-3-one |
|---|---|
| PubChem CID | 11162864 |
| Molecular Formula | C16H14BrNO |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | (4S)-8-bromo-2-methyl-4-phenyl-1,4-dihydroisoquinolin-3-one |
| SMILES | CN1Cc2c(Br)cccc2[C@H](c2ccccc2)C1=O |
| InChI | InChI=1S/C16H14BrNO/c1-18-10-13-12(8-5-9-14(13)17)15(16(18)19)11-6-3-2-4-7-11/h2-9,15H,10H2,1H3/t15-/m0/s1 |
| InChIKey | BVNJNDHMDMECFA-HNNXBMFYSA-N |
| XLogP | 3.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |