C15H12N2S3 — CID 11162886
(4R,5S)-2,4,5-trithiophen-2-yl-4,5-dihydro-1H-imidazole (PubChem CID 11162886) has the molecular formula C15H12N2S3 and a molecular weight of 316.48 g/mol. Its IUPAC name is (4R,5S)-2,4,5-trithiophen-2-yl-4,5-dihydro-1H-imidazole.
| Compound Name | (4R,5S)-2,4,5-trithiophen-2-yl-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 11162886 |
| Molecular Formula | C15H12N2S3 |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | (4R,5S)-2,4,5-trithiophen-2-yl-4,5-dihydro-1H-imidazole |
| SMILES | c1csc(C2=N[C@@H](c3cccs3)[C@@H](c3cccs3)N2)c1 |
| InChI | InChI=1S/C15H12N2S3/c1-4-10(18-7-1)13-14(11-5-2-8-19-11)17-15(16-13)12-6-3-9-20-12/h1-9,13-14H,(H,16,17)/t13-,14+ |
| InChIKey | CHAHLJPKSHDPTQ-OKILXGFUSA-N |
| XLogP | 4.70 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |