C19H27NO3 — CID 11162911
(2R,3R,5Z,8R)-2-ethyl-N,N-dimethyl-3-phenylmethoxy-3,4,7,8-tetrahydro-2H-oxocine-8-carboxamide (PubChem CID 11162911) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (2R,3R,5Z,8R)-2-ethyl-N,N-dimethyl-3-phenylmethoxy-3,4,7,8-tetrahydro-2H-oxocine-8-carboxamide.
| Compound Name | (2R,3R,5Z,8R)-2-ethyl-N,N-dimethyl-3-phenylmethoxy-3,4,7,8-tetrahydro-2H-oxocine-8-carboxamide |
|---|---|
| PubChem CID | 11162911 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (2R,3R,5Z,8R)-2-ethyl-N,N-dimethyl-3-phenylmethoxy-3,4,7,8-tetrahydro-2H-oxocine-8-carboxamide |
| SMILES | CC[C@H]1O[C@@H](C(=O)N(C)C)C/C=C\C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H27NO3/c1-4-16-17(22-14-15-10-6-5-7-11-15)12-8-9-13-18(23-16)19(21)20(2)3/h5-11,16-18H,4,12-14H2,1-3H3/b9-8-/t16-,17-,18-/m1/s1 |
| InChIKey | YURONHPYJQNSCN-RVLODESQSA-N |
| XLogP | 3.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|