C14H21NOS — CID 111629539
3-[[(2,3-dimethylphenyl)methylamino]methyl]thiolan-3-ol (PubChem CID 111629539) has the molecular formula C14H21NOS and a molecular weight of 251.39 g/mol. Its IUPAC name is 3-[[(2,3-dimethylphenyl)methylamino]methyl]thiolan-3-ol.
| Compound Name | 3-[[(2,3-dimethylphenyl)methylamino]methyl]thiolan-3-ol |
|---|---|
| PubChem CID | 111629539 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 3-[[(2,3-dimethylphenyl)methylamino]methyl]thiolan-3-ol |
| SMILES | Cc1cccc(CNCC2(O)CCSC2)c1C |
| InChI | InChI=1S/C14H21NOS/c1-11-4-3-5-13(12(11)2)8-15-9-14(16)6-7-17-10-14/h3-5,15-16H,6-10H2,1-2H3 |
| InChIKey | XIMIYJWXLZJQQT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |