C13H22F3N3O2 — CID 111630617
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea (PubChem CID 111630617) has the molecular formula C13H22F3N3O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea.
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea |
|---|---|
| PubChem CID | 111630617 |
| Molecular Formula | C13H22F3N3O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea |
| SMILES | CN(CCCNC(=O)N[C@@H]1C=C[C@H](CO)C1)CC(F)(F)F |
| InChI | InChI=1S/C13H22F3N3O2/c1-19(9-13(14,15)16)6-2-5-17-12(21)18-11-4-3-10(7-11)8-20/h3-4,10-11,20H,2,5-9H2,1H3,(H2,17,18,21)/t10-,11+/m0/s1 |
| InChIKey | OPARDUHHVJGWDT-WDEREUQCSA-N |
| XLogP | 1.11 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|