About N-[(E)-2-[(2S)-3,3-dimethoxy-2-phenylmethoxypropyl]hex-4-enyl]hydroxylamine
N-[(E)-2-[(2S)-3,3-dimethoxy-2-phenylmethoxypropyl]hex-4-enyl]hydroxylamine (PubChem CID 11163104) has the molecular formula C18H29NO4
and a molecular weight of 323.43 g/mol. Its IUPAC name is N-[(E)-2-[(2S)-3,3-dimethoxy-2-phenylmethoxypropyl]hex-4-enyl]hydroxylamine.
Molecular Properties
| Compound Name | N-[(E)-2-[(2S)-3,3-dimethoxy-2-phenylmethoxypropyl]hex-4-enyl]hydroxylamine |
| PubChem CID | 11163104 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | N-[(E)-2-[(2S)-3,3-dimethoxy-2-phenylmethoxypropyl]hex-4-enyl]hydroxylamine |
| SMILES | C/C=C/CC(CNO)C[C@H](OCc1ccccc1)C(OC)OC |
| InChI | InChI=1S/C18H29NO4/c1-4-5-9-16(13-19-20)12-17(18(21-2)22-3)23-14-15-10-7-6-8-11-15/h4-8,10-11,16-20H,9,12-14H2,1-3H3/b5-4+/t16?,17-/m0/s1 |
| InChIKey | KXGJXQVNEMEJJI-JNMRIYKTSA-N |
| XLogP | 3.14 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-2-[(2S)-3,3-dimethoxy-2-phenylmethoxypropyl]hex-4-enyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-2-[(2S)-3,3-dimethoxy-2-phenylmethoxypropyl]hex-4-enyl]hydroxylamine?
The IUPAC name of N-[(E)-2-[(2S)-3,3-dimethoxy-2-phenylmethoxypropyl]hex-4-enyl]hydroxylamine (CID 11163104) is N-[(E)-2-[(2S)-3,3-dimethoxy-2-phenylmethoxypropyl]hex-4-enyl]hydroxylamine.
What is the SMILES notation for N-[(E)-2-[(2S)-3,3-dimethoxy-2-phenylmethoxypropyl]hex-4-enyl]hydroxylamine?
The canonical SMILES for N-[(E)-2-[(2S)-3,3-dimethoxy-2-phenylmethoxypropyl]hex-4-enyl]hydroxylamine is C/C=C/CC(CNO)C[C@H](OCc1ccccc1)C(OC)OC.
What is the InChIKey of N-[(E)-2-[(2S)-3,3-dimethoxy-2-phenylmethoxypropyl]hex-4-enyl]hydroxylamine?
The InChIKey is KXGJXQVNEMEJJI-JNMRIYKTSA-N. The full InChI is InChI=1S/C18H29NO4/c1-4-5-9-16(13-19-20)12-17(18(21-2)22-3)23-14-15-10-7-6-8-11-15/h4-8,10-11,16-20H,9,12-14H2,1-3H3/b5-4+/t16?,17-/m0/s1.
What are the key properties of N-[(E)-2-[(2S)-3,3-dimethoxy-2-phenylmethoxypropyl]hex-4-enyl]hydroxylamine?
N-[(E)-2-[(2S)-3,3-dimethoxy-2-phenylmethoxypropyl]hex-4-enyl]hydroxylamine has a molecular weight of 323.43 g/mol, XLogP of 3.14, 12 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-2-[(2S)-3,3-dimethoxy-2-phenylmethoxypropyl]hex-4-enyl]hydroxylamine is sourced from PubChem (CID 11163104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).