C10H15F3N2O2 — CID 111631247
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(3,3,3-trifluoropropyl)urea (PubChem CID 111631247) has the molecular formula C10H15F3N2O2 and a molecular weight of 252.24 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(3,3,3-trifluoropropyl)urea.
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 111631247 |
| Molecular Formula | C10H15F3N2O2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(3,3,3-trifluoropropyl)urea |
| SMILES | O=C(NCCC(F)(F)F)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C10H15F3N2O2/c11-10(12,13)3-4-14-9(17)15-8-2-1-7(5-8)6-16/h1-2,7-8,16H,3-6H2,(H2,14,15,17)/t7-,8+/m0/s1 |
| InChIKey | AKYFNJKNAXUFLZ-JGVFFNPUSA-N |
| XLogP | 1.17 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|