C15H19N5O2 — CID 111631445
1-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea (PubChem CID 111631445) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea.
| Compound Name | 1-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea |
|---|---|
| PubChem CID | 111631445 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 1-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea |
| SMILES | Cc1nn(C)c2ncc(NC(=O)N[C@@H]3C=C[C@H](CO)C3)cc12 |
| InChI | InChI=1S/C15H19N5O2/c1-9-13-6-12(7-16-14(13)20(2)19-9)18-15(22)17-11-4-3-10(5-11)8-21/h3-4,6-7,10-11,21H,5,8H2,1-2H3,(H2,17,18,22)/t10-,11+/m0/s1 |
| InChIKey | AXMLVXKFXFPMCJ-WDEREUQCSA-N |
| XLogP | 1.34 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|