C18H29N5O3S — CID 111631546
3-[2-[[N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide (PubChem CID 111631546) has the molecular formula C18H29N5O3S and a molecular weight of 395.53 g/mol. Its IUPAC name is 3-[2-[[N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide.
| Compound Name | 3-[2-[[N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111631546 |
| Molecular Formula | C18H29N5O3S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 3-[2-[[N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
| SMILES | C/N=C(\NCCc1cccc(C(=O)NC)c1)NCCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C18H29N5O3S/c1-19-17(24)16-5-3-4-15(14-16)6-7-21-18(20-2)22-8-9-23-10-12-27(25,26)13-11-23/h3-5,14H,6-13H2,1-2H3,(H,19,24)(H2,20,21,22) |
| InChIKey | PPUZEZQBVMZJNY-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|