About trimethyl-(2,2,2-trifluoro-1-phenyl-1-pyridin-2-ylethoxy)silane
trimethyl-(2,2,2-trifluoro-1-phenyl-1-pyridin-2-ylethoxy)silane (PubChem CID 11163162) has the molecular formula C16H18F3NOSi
and a molecular weight of 325.41 g/mol. Its IUPAC name is trimethyl-(2,2,2-trifluoro-1-phenyl-1-pyridin-2-ylethoxy)silane.
Molecular Properties
| Compound Name | trimethyl-(2,2,2-trifluoro-1-phenyl-1-pyridin-2-ylethoxy)silane |
| PubChem CID | 11163162 |
| Molecular Formula | C16H18F3NOSi |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | trimethyl-(2,2,2-trifluoro-1-phenyl-1-pyridin-2-ylethoxy)silane |
| SMILES | C[Si](C)(C)OC(c1ccccc1)(c1ccccn1)C(F)(F)F |
| InChI | InChI=1S/C16H18F3NOSi/c1-22(2,3)21-15(16(17,18)19,13-9-5-4-6-10-13)14-11-7-8-12-20-14/h4-12H,1-3H3 |
| InChIKey | IYIJAZSRNWLCDS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-(2,2,2-trifluoro-1-phenyl-1-pyridin-2-ylethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-(2,2,2-trifluoro-1-phenyl-1-pyridin-2-ylethoxy)silane?
The IUPAC name of trimethyl-(2,2,2-trifluoro-1-phenyl-1-pyridin-2-ylethoxy)silane (CID 11163162) is trimethyl-(2,2,2-trifluoro-1-phenyl-1-pyridin-2-ylethoxy)silane.
What is the SMILES notation for trimethyl-(2,2,2-trifluoro-1-phenyl-1-pyridin-2-ylethoxy)silane?
The canonical SMILES for trimethyl-(2,2,2-trifluoro-1-phenyl-1-pyridin-2-ylethoxy)silane is C[Si](C)(C)OC(c1ccccc1)(c1ccccn1)C(F)(F)F.
What is the InChIKey of trimethyl-(2,2,2-trifluoro-1-phenyl-1-pyridin-2-ylethoxy)silane?
The InChIKey is IYIJAZSRNWLCDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F3NOSi/c1-22(2,3)21-15(16(17,18)19,13-9-5-4-6-10-13)14-11-7-8-12-20-14/h4-12H,1-3H3.
What are the key properties of trimethyl-(2,2,2-trifluoro-1-phenyl-1-pyridin-2-ylethoxy)silane?
trimethyl-(2,2,2-trifluoro-1-phenyl-1-pyridin-2-ylethoxy)silane has a molecular weight of 325.41 g/mol, XLogP of 4.74, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-(2,2,2-trifluoro-1-phenyl-1-pyridin-2-ylethoxy)silane is sourced from PubChem (CID 11163162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).