C22H31N5O — CID 111632016
3-[2-[[N-[[3-[(dimethylamino)methyl]phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide (PubChem CID 111632016) has the molecular formula C22H31N5O and a molecular weight of 381.52 g/mol. Its IUPAC name is 3-[2-[[N-[[3-[(dimethylamino)methyl]phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide.
| Compound Name | 3-[2-[[N-[[3-[(dimethylamino)methyl]phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111632016 |
| Molecular Formula | C22H31N5O |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 3-[2-[[N-[[3-[(dimethylamino)methyl]phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
| SMILES | C/N=C(/NCCc1cccc(C(=O)NC)c1)NCc1cccc(CN(C)C)c1 |
| InChI | InChI=1S/C22H31N5O/c1-23-21(28)20-10-6-7-17(14-20)11-12-25-22(24-2)26-15-18-8-5-9-19(13-18)16-27(3)4/h5-10,13-14H,11-12,15-16H2,1-4H3,(H,23,28)(H2,24,25,26) |
| InChIKey | RFZYAHBBEORUQQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|