C26H30FIN4O2 — CID 111632454
3-[2-[[N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide (PubChem CID 111632454) has the molecular formula C26H30FIN4O2 and a molecular weight of 576.45 g/mol. Its IUPAC name is 3-[2-[[N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[2-[[N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111632454 |
| Molecular Formula | C26H30FIN4O2 |
| Molecular Weight | 576.45 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | 3-[2-[[N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
| SMILES | C/N=C(/NCCc1cccc(C(=O)NC)c1)NCc1ccc(OCc2cccc(F)c2)cc1.I |
| InChI | InChI=1S/C26H29FN4O2.HI/c1-28-25(32)22-7-3-5-19(15-22)13-14-30-26(29-2)31-17-20-9-11-24(12-10-20)33-18-21-6-4-8-23(27)16-21;/h3-12,15-16H,13-14,17-18H2,1-2H3,(H,28,32)(H2,29,30,31);1H |
| InChIKey | GIGJDDFWGSTTCW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|