C22H27F3N4O2 — CID 111632543
3-[2-[[ethylamino-[2-[4-(trifluoromethyl)phenoxy]ethylamino]methylidene]amino]ethyl]-N-methylbenzamide (PubChem CID 111632543) has the molecular formula C22H27F3N4O2 and a molecular weight of 436.48 g/mol. Its IUPAC name is 3-[2-[[ethylamino-[2-[4-(trifluoromethyl)phenoxy]ethylamino]methylidene]amino]ethyl]-N-methylbenzamide.
| Compound Name | 3-[2-[[ethylamino-[2-[4-(trifluoromethyl)phenoxy]ethylamino]methylidene]amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111632543 |
| Molecular Formula | C22H27F3N4O2 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 3-[2-[[ethylamino-[2-[4-(trifluoromethyl)phenoxy]ethylamino]methylidene]amino]ethyl]-N-methylbenzamide |
| SMILES | CCN/C(=N\CCc1cccc(C(=O)NC)c1)NCCOc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H27F3N4O2/c1-3-27-21(28-12-11-16-5-4-6-17(15-16)20(30)26-2)29-13-14-31-19-9-7-18(8-10-19)22(23,24)25/h4-10,15H,3,11-14H2,1-2H3,(H,26,30)(H2,27,28,29) |
| InChIKey | OHRKOXVSBSRABH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|