C17H32O4Si — CID 11163278
2-[[(2R,4S)-2-[(E)-4-(methoxymethoxy)but-1-enyl]-1,3-dioxan-4-yl]methyl]prop-2-enyl-trimethylsilane (PubChem CID 11163278) has the molecular formula C17H32O4Si and a molecular weight of 328.53 g/mol. Its IUPAC name is 2-[[(2R,4S)-2-[(E)-4-(methoxymethoxy)but-1-enyl]-1,3-dioxan-4-yl]methyl]prop-2-enyl-trimethylsilane.
| Compound Name | 2-[[(2R,4S)-2-[(E)-4-(methoxymethoxy)but-1-enyl]-1,3-dioxan-4-yl]methyl]prop-2-enyl-trimethylsilane |
|---|---|
| PubChem CID | 11163278 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 2-[[(2R,4S)-2-[(E)-4-(methoxymethoxy)but-1-enyl]-1,3-dioxan-4-yl]methyl]prop-2-enyl-trimethylsilane |
| SMILES | C=C(C[C@H]1CCO[C@@H](/C=C/CCOCOC)O1)C[Si](C)(C)C |
| InChI | InChI=1S/C17H32O4Si/c1-15(13-22(3,4)5)12-16-9-11-20-17(21-16)8-6-7-10-19-14-18-2/h6,8,16-17H,1,7,9-14H2,2-5H3/b8-6+/t16-,17-/m1/s1 |
| InChIKey | VFUJBCASPQFIRK-WPLBAPSMSA-N |
| XLogP | 3.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|