About 4-[3-(furan-2-yl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide
4-[3-(furan-2-yl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide (PubChem CID 11163395) has the molecular formula C16H15NO5S
and a molecular weight of 333.37 g/mol. Its IUPAC name is 4-[3-(furan-2-yl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[3-(furan-2-yl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide |
| PubChem CID | 11163395 |
| Molecular Formula | C16H15NO5S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 4-[3-(furan-2-yl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide |
| SMILES | CC1(C)OC(c2ccc(S(N)(=O)=O)cc2)=C(c2ccco2)C1=O |
| InChI | InChI=1S/C16H15NO5S/c1-16(2)15(18)13(12-4-3-9-21-12)14(22-16)10-5-7-11(8-6-10)23(17,19)20/h3-9H,1-2H3,(H2,17,19,20) |
| InChIKey | YCFUZEFTLBDSHJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[3-(furan-2-yl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(furan-2-yl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide?
The IUPAC name of 4-[3-(furan-2-yl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide (CID 11163395) is 4-[3-(furan-2-yl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide.
What is the SMILES notation for 4-[3-(furan-2-yl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide?
The canonical SMILES for 4-[3-(furan-2-yl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide is CC1(C)OC(c2ccc(S(N)(=O)=O)cc2)=C(c2ccco2)C1=O.
What is the InChIKey of 4-[3-(furan-2-yl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide?
The InChIKey is YCFUZEFTLBDSHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO5S/c1-16(2)15(18)13(12-4-3-9-21-12)14(22-16)10-5-7-11(8-6-10)23(17,19)20/h3-9H,1-2H3,(H2,17,19,20).
What are the key properties of 4-[3-(furan-2-yl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide?
4-[3-(furan-2-yl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide has a molecular weight of 333.37 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(furan-2-yl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide is sourced from PubChem (CID 11163395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).