C14H8Cl3N3O — CID 11163623
4-chloro-1-(3-chlorophenyl)-3-methylpyrazolo[3,4-b]pyridine-5-carbonyl chloride (PubChem CID 11163623) has the molecular formula C14H8Cl3N3O and a molecular weight of 340.60 g/mol. Its IUPAC name is 4-chloro-1-(3-chlorophenyl)-3-methylpyrazolo[3,4-b]pyridine-5-carbonyl chloride.
| Compound Name | 4-chloro-1-(3-chlorophenyl)-3-methylpyrazolo[3,4-b]pyridine-5-carbonyl chloride |
|---|---|
| PubChem CID | 11163623 |
| Molecular Formula | C14H8Cl3N3O |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 4-chloro-1-(3-chlorophenyl)-3-methylpyrazolo[3,4-b]pyridine-5-carbonyl chloride |
| SMILES | Cc1nn(-c2cccc(Cl)c2)c2ncc(C(=O)Cl)c(Cl)c12 |
| InChI | InChI=1S/C14H8Cl3N3O/c1-7-11-12(16)10(13(17)21)6-18-14(11)20(19-7)9-4-2-3-8(15)5-9/h2-6H,1H3 |
| InChIKey | ONBIWDUEFNCUOU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|