C16H23NO7 — CID 11163641
3-O-tert-butyl 2-O,6-O-diethyl (1S,2S,5R,6R)-4-oxo-3-azabicyclo[3.1.0]hexane-2,3,6-tricarboxylate (PubChem CID 11163641) has the molecular formula C16H23NO7 and a molecular weight of 341.36 g/mol. Its IUPAC name is 3-O-tert-butyl 2-O,6-O-diethyl (1S,2S,5R,6R)-4-oxo-3-azabicyclo[3.1.0]hexane-2,3,6-tricarboxylate.
| Compound Name | 3-O-tert-butyl 2-O,6-O-diethyl (1S,2S,5R,6R)-4-oxo-3-azabicyclo[3.1.0]hexane-2,3,6-tricarboxylate |
|---|---|
| PubChem CID | 11163641 |
| Molecular Formula | C16H23NO7 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 3-O-tert-butyl 2-O,6-O-diethyl (1S,2S,5R,6R)-4-oxo-3-azabicyclo[3.1.0]hexane-2,3,6-tricarboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2C(=O)N(C(=O)OC(C)(C)C)[C@H](C(=O)OCC)[C@H]12 |
| InChI | InChI=1S/C16H23NO7/c1-6-22-13(19)10-8-9(10)12(18)17(11(8)14(20)23-7-2)15(21)24-16(3,4)5/h8-11H,6-7H2,1-5H3/t8-,9+,10+,11-/m0/s1 |
| InChIKey | IITFLDIDDLOOHI-ZDCRXTMVSA-N |
| XLogP | 1.12 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|