C20H17N3O3 — CID 11163829
(6-methyl-9-phenyl-13,15-dioxa-4,7,8-triazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),3,5,8,10,12(16)-hexaen-5-yl)methanol (PubChem CID 11163829) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is (6-methyl-9-phenyl-13,15-dioxa-4,7,8-triazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),3,5,8,10,12(16)-hexaen-5-yl)methanol.
| Compound Name | (6-methyl-9-phenyl-13,15-dioxa-4,7,8-triazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),3,5,8,10,12(16)-hexaen-5-yl)methanol |
|---|---|
| PubChem CID | 11163829 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (6-methyl-9-phenyl-13,15-dioxa-4,7,8-triazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),3,5,8,10,12(16)-hexaen-5-yl)methanol |
| SMILES | Cc1c(CO)nc2n1N=C(c1ccccc1)c1cc3c(cc1C2)OCO3 |
| InChI | InChI=1S/C20H17N3O3/c1-12-16(10-24)21-19-8-14-7-17-18(26-11-25-17)9-15(14)20(22-23(12)19)13-5-3-2-4-6-13/h2-7,9,24H,8,10-11H2,1H3 |
| InChIKey | USQMHKFXMVOWDR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |