1-(3-fluorophenyl)dibenzofuran-4,6-dicarboxylic acid

C20H11FO5 — CID 11163918

IUPAC1-(3-fluorophenyl)dibenzofuran-4,6-dicarboxylic acid
SMILESO=C(O)c1cccc2c1oc1c(C(=O)O)ccc(-c3cccc(F)c3)c12
InChIInChI=1S/C20H11FO5/c21-11-4-1-3-10(9-11)12-7-8-15(20(24)25)18-16(12)13-5-2-6-14(19(22)23)17(13)26-18/h1-9H,(H,22,23)(H,24,25)
InChIKeyWMGJIGRCEZYLFX-UHFFFAOYSA-N
MW350.30 g/mol
LogP4.79
Rot. Bonds3

About 1-(3-fluorophenyl)dibenzofuran-4,6-dicarboxylic acid

1-(3-fluorophenyl)dibenzofuran-4,6-dicarboxylic acid (PubChem CID 11163918) has the molecular formula C20H11FO5 and a molecular weight of 350.30 g/mol. Its IUPAC name is 1-(3-fluorophenyl)dibenzofuran-4,6-dicarboxylic acid.

Molecular Properties

Compound Name1-(3-fluorophenyl)dibenzofuran-4,6-dicarboxylic acid
PubChem CID11163918
Molecular FormulaC20H11FO5
Molecular Weight350.30 g/mol
Exact Mass350.06
IUPAC Name1-(3-fluorophenyl)dibenzofuran-4,6-dicarboxylic acid
SMILESO=C(O)c1cccc2c1oc1c(C(=O)O)ccc(-c3cccc(F)c3)c12
InChIInChI=1S/C20H11FO5/c21-11-4-1-3-10(9-11)12-7-8-15(20(24)25)18-16(12)13-5-2-6-14(19(22)23)17(13)26-18/h1-9H,(H,22,23)(H,24,25)
InChIKeyWMGJIGRCEZYLFX-UHFFFAOYSA-N
XLogP4.79
TPSA87.74 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500350.30
LogP ≤ 54.79
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 1-(3-fluorophenyl)dibenzofuran-4,6-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(3-fluorophenyl)dibenzofuran-4,6-dicarboxylic acid?
The IUPAC name of 1-(3-fluorophenyl)dibenzofuran-4,6-dicarboxylic acid (CID 11163918) is 1-(3-fluorophenyl)dibenzofuran-4,6-dicarboxylic acid.
What is the SMILES notation for 1-(3-fluorophenyl)dibenzofuran-4,6-dicarboxylic acid?
The canonical SMILES for 1-(3-fluorophenyl)dibenzofuran-4,6-dicarboxylic acid is O=C(O)c1cccc2c1oc1c(C(=O)O)ccc(-c3cccc(F)c3)c12.
What is the InChIKey of 1-(3-fluorophenyl)dibenzofuran-4,6-dicarboxylic acid?
The InChIKey is WMGJIGRCEZYLFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H11FO5/c21-11-4-1-3-10(9-11)12-7-8-15(20(24)25)18-16(12)13-5-2-6-14(19(22)23)17(13)26-18/h1-9H,(H,22,23)(H,24,25).
What are the key properties of 1-(3-fluorophenyl)dibenzofuran-4,6-dicarboxylic acid?
1-(3-fluorophenyl)dibenzofuran-4,6-dicarboxylic acid has a molecular weight of 350.30 g/mol, XLogP of 4.79, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-fluorophenyl)dibenzofuran-4,6-dicarboxylic acid is sourced from PubChem (CID 11163918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).