C20H17NO3S — CID 11163959
(3R,4R,5R)-3-naphthalen-1-yl-4-nitro-5-thiophen-2-ylcyclohexan-1-one (PubChem CID 11163959) has the molecular formula C20H17NO3S and a molecular weight of 351.43 g/mol. Its IUPAC name is (3R,4R,5R)-3-naphthalen-1-yl-4-nitro-5-thiophen-2-ylcyclohexan-1-one.
| Compound Name | (3R,4R,5R)-3-naphthalen-1-yl-4-nitro-5-thiophen-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 11163959 |
| Molecular Formula | C20H17NO3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | (3R,4R,5R)-3-naphthalen-1-yl-4-nitro-5-thiophen-2-ylcyclohexan-1-one |
| SMILES | O=C1C[C@H](c2cccc3ccccc23)[C@@H]([N+](=O)[O-])[C@H](c2cccs2)C1 |
| InChI | InChI=1S/C20H17NO3S/c22-14-11-17(16-8-3-6-13-5-1-2-7-15(13)16)20(21(23)24)18(12-14)19-9-4-10-25-19/h1-10,17-18,20H,11-12H2/t17-,18+,20-/m1/s1 |
| InChIKey | ZWHNKVUTBCXUAJ-WSTZPKSXSA-N |
| XLogP | 4.78 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|