C16H18ClN3O2S — CID 11163971
3-chloro-4-(3,3-dimethylbutanoylamino)-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 11163971) has the molecular formula C16H18ClN3O2S and a molecular weight of 351.86 g/mol. Its IUPAC name is 3-chloro-4-(3,3-dimethylbutanoylamino)-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-chloro-4-(3,3-dimethylbutanoylamino)-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 11163971 |
| Molecular Formula | C16H18ClN3O2S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 3-chloro-4-(3,3-dimethylbutanoylamino)-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | CC(C)(C)CC(=O)Nc1ccc(C(=O)Nc2nccs2)cc1Cl |
| InChI | InChI=1S/C16H18ClN3O2S/c1-16(2,3)9-13(21)19-12-5-4-10(8-11(12)17)14(22)20-15-18-6-7-23-15/h4-8H,9H2,1-3H3,(H,19,21)(H,18,20,22) |
| InChIKey | GZDQVVAHFIVIHT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |