C18H29ClIN3O — CID 111640177
1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-(5-methoxypentyl)-2-methylguanidine;hydroiodide (PubChem CID 111640177) has the molecular formula C18H29ClIN3O and a molecular weight of 465.81 g/mol. Its IUPAC name is 1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-(5-methoxypentyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-(5-methoxypentyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111640177 |
| Molecular Formula | C18H29ClIN3O |
| Molecular Weight | 465.81 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-(5-methoxypentyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCCOC)NCC1(c2cccc(Cl)c2)CC1.I |
| InChI | InChI=1S/C18H28ClN3O.HI/c1-20-17(21-11-4-3-5-12-23-2)22-14-18(9-10-18)15-7-6-8-16(19)13-15;/h6-8,13H,3-5,9-12,14H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | NGYCTCDNMYFOKV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.81 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|