C22H37ClIN5 — CID 111640221
2-[[1-(3-chlorophenyl)cyclopropyl]methyl]-1-ethyl-3-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111640221) has the molecular formula C22H37ClIN5 and a molecular weight of 533.93 g/mol. Its IUPAC name is 2-[[1-(3-chlorophenyl)cyclopropyl]methyl]-1-ethyl-3-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-[[1-(3-chlorophenyl)cyclopropyl]methyl]-1-ethyl-3-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111640221 |
| Molecular Formula | C22H37ClIN5 |
| Molecular Weight | 533.93 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 2-[[1-(3-chlorophenyl)cyclopropyl]methyl]-1-ethyl-3-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2cccc(Cl)c2)CC1)NCC(C)CN1CCN(C)CC1.I |
| InChI | InChI=1S/C22H36ClN5.HI/c1-4-24-21(25-15-18(2)16-28-12-10-27(3)11-13-28)26-17-22(8-9-22)19-6-5-7-20(23)14-19;/h5-7,14,18H,4,8-13,15-17H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | XAOQWJXWUHBAAP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.93 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|