C9H5F11O2 — CID 11164047
2-[[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]oxymethyl]oxirane (PubChem CID 11164047) has the molecular formula C9H5F11O2 and a molecular weight of 354.12 g/mol. Its IUPAC name is 2-[[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]oxymethyl]oxirane.
| Compound Name | 2-[[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 11164047 |
| Molecular Formula | C9H5F11O2 |
| Molecular Weight | 354.12 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 2-[[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]oxymethyl]oxirane |
| SMILES | FC(F)(F)C(=C(OCC1CO1)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H5F11O2/c10-6(11,9(18,19)20)5(22-2-3-1-21-3)4(7(12,13)14)8(15,16)17/h3H,1-2H2 |
| InChIKey | RNGCLMCGFMZPLT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.12 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|