C19H18N2O5 — CID 11164056
oxalic acid;2-[(2S,3S)-3-(2-phenylphenyl)oxiran-2-yl]-4,5-dihydro-1H-imidazole (PubChem CID 11164056) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is oxalic acid;2-[(2S,3S)-3-(2-phenylphenyl)oxiran-2-yl]-4,5-dihydro-1H-imidazole.
| Compound Name | oxalic acid;2-[(2S,3S)-3-(2-phenylphenyl)oxiran-2-yl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 11164056 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | oxalic acid;2-[(2S,3S)-3-(2-phenylphenyl)oxiran-2-yl]-4,5-dihydro-1H-imidazole |
| SMILES | O=C(O)C(=O)O.c1ccc(-c2ccccc2[C@@H]2O[C@H]2C2=NCCN2)cc1 |
| InChI | InChI=1S/C17H16N2O.C2H2O4/c1-2-6-12(7-3-1)13-8-4-5-9-14(13)15-16(20-15)17-18-10-11-19-17;3-1(4)2(5)6/h1-9,15-16H,10-11H2,(H,18,19);(H,3,4)(H,5,6)/t15-,16+;/m0./s1 |
| InChIKey | LWEOSPJXOKMJKX-IDVLALEDSA-N |
| XLogP | 1.95 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|