C24H36IN5O2 — CID 111640581
1-[4-[[[N-[3-(4-methoxyphenyl)butyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide (PubChem CID 111640581) has the molecular formula C24H36IN5O2 and a molecular weight of 553.49 g/mol. Its IUPAC name is 1-[4-[[[N-[3-(4-methoxyphenyl)butyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide.
| Compound Name | 1-[4-[[[N-[3-(4-methoxyphenyl)butyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
|---|---|
| PubChem CID | 111640581 |
| Molecular Formula | C24H36IN5O2 |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | 1-[4-[[[N-[3-(4-methoxyphenyl)butyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
| SMILES | C/N=C(\NCCC(C)c1ccc(OC)cc1)NCc1ccc(NC(=O)NC(C)C)cc1.I |
| InChI | InChI=1S/C24H35N5O2.HI/c1-17(2)28-24(30)29-21-10-6-19(7-11-21)16-27-23(25-4)26-15-14-18(3)20-8-12-22(31-5)13-9-20;/h6-13,17-18H,14-16H2,1-5H3,(H2,25,26,27)(H2,28,29,30);1H |
| InChIKey | HKUBYWHRDZCJJJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|