C25H38IN5O2 — CID 111641783
N-[2-(dimethylamino)ethyl]-3-[[[N-[3-(4-methoxyphenyl)butyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111641783) has the molecular formula C25H38IN5O2 and a molecular weight of 567.52 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-[[[N-[3-(4-methoxyphenyl)butyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-[[[N-[3-(4-methoxyphenyl)butyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111641783 |
| Molecular Formula | C25H38IN5O2 |
| Molecular Weight | 567.52 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-[[[N-[3-(4-methoxyphenyl)butyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | C/N=C(\NCCC(C)c1ccc(OC)cc1)NCc1cccc(C(=O)NCCN(C)C)c1.I |
| InChI | InChI=1S/C25H37N5O2.HI/c1-19(21-9-11-23(32-5)12-10-21)13-14-28-25(26-2)29-18-20-7-6-8-22(17-20)24(31)27-15-16-30(3)4;/h6-12,17,19H,13-16,18H2,1-5H3,(H,27,31)(H2,26,28,29);1H |
| InChIKey | RRORLZCDHAFBQA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|