C22H35IN4O3 — CID 111642147
2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111642147) has the molecular formula C22H35IN4O3 and a molecular weight of 530.45 g/mol. Its IUPAC name is 2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111642147 |
| Molecular Formula | C22H35IN4O3 |
| Molecular Weight | 530.45 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | 2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N1CCc2ccccc21)NCCCOCC1CCOCC1.I |
| InChI | InChI=1S/C22H34N4O3.HI/c1-2-23-22(24-11-5-13-29-17-18-9-14-28-15-10-18)25-16-21(27)26-12-8-19-6-3-4-7-20(19)26;/h3-4,6-7,18H,2,5,8-17H2,1H3,(H2,23,24,25);1H |
| InChIKey | LYBJNVMGMAWVFT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|