C23H34O3 — CID 11164221
2-[(2R,3S,6S)-3-methyl-6-[(E,2R)-6-methyl-2-phenylmethoxyhept-3-enyl]oxan-2-yl]acetaldehyde (PubChem CID 11164221) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is 2-[(2R,3S,6S)-3-methyl-6-[(E,2R)-6-methyl-2-phenylmethoxyhept-3-enyl]oxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2R,3S,6S)-3-methyl-6-[(E,2R)-6-methyl-2-phenylmethoxyhept-3-enyl]oxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 11164221 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 2-[(2R,3S,6S)-3-methyl-6-[(E,2R)-6-methyl-2-phenylmethoxyhept-3-enyl]oxan-2-yl]acetaldehyde |
| SMILES | CC(C)C/C=C/[C@@H](C[C@@H]1CC[C@H](C)[C@@H](CC=O)O1)OCc1ccccc1 |
| InChI | InChI=1S/C23H34O3/c1-18(2)8-7-11-21(25-17-20-9-5-4-6-10-20)16-22-13-12-19(3)23(26-22)14-15-24/h4-7,9-11,15,18-19,21-23H,8,12-14,16-17H2,1-3H3/b11-7+/t19-,21-,22-,23+/m0/s1 |
| InChIKey | HDSRDTKWVBXZAS-FXVVSLRXSA-N |
| XLogP | 5.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|