C24H25NO2 — CID 11164252
(5R)-5-cyclohexyl-2-phenyl-5-[(1S)-1-phenylprop-2-enyl]-1,3-oxazol-4-one (PubChem CID 11164252) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is (5R)-5-cyclohexyl-2-phenyl-5-[(1S)-1-phenylprop-2-enyl]-1,3-oxazol-4-one.
| Compound Name | (5R)-5-cyclohexyl-2-phenyl-5-[(1S)-1-phenylprop-2-enyl]-1,3-oxazol-4-one |
|---|---|
| PubChem CID | 11164252 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (5R)-5-cyclohexyl-2-phenyl-5-[(1S)-1-phenylprop-2-enyl]-1,3-oxazol-4-one |
| SMILES | C=C[C@@H](c1ccccc1)[C@@]1(C2CCCCC2)OC(c2ccccc2)=NC1=O |
| InChI | InChI=1S/C24H25NO2/c1-2-21(18-12-6-3-7-13-18)24(20-16-10-5-11-17-20)23(26)25-22(27-24)19-14-8-4-9-15-19/h2-4,6-9,12-15,20-21H,1,5,10-11,16-17H2/t21-,24+/m0/s1 |
| InChIKey | HBIGNXZTNYBPIR-XUZZJYLKSA-N |
| XLogP | 5.28 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|