C22H32O4 — CID 11164291
2-hydroxy-5-[(1E,3E,5E,7R,8R,9E)-8-hydroxy-7,9,12-trimethyltrideca-1,3,5,9-tetraenyl]-2,4-dimethylfuran-3-one (PubChem CID 11164291) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is 2-hydroxy-5-[(1E,3E,5E,7R,8R,9E)-8-hydroxy-7,9,12-trimethyltrideca-1,3,5,9-tetraenyl]-2,4-dimethylfuran-3-one.
| Compound Name | 2-hydroxy-5-[(1E,3E,5E,7R,8R,9E)-8-hydroxy-7,9,12-trimethyltrideca-1,3,5,9-tetraenyl]-2,4-dimethylfuran-3-one |
|---|---|
| PubChem CID | 11164291 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 2-hydroxy-5-[(1E,3E,5E,7R,8R,9E)-8-hydroxy-7,9,12-trimethyltrideca-1,3,5,9-tetraenyl]-2,4-dimethylfuran-3-one |
| SMILES | CC1=C(/C=C/C=C/C=C/[C@@H](C)[C@@H](O)/C(C)=C/CC(C)C)OC(C)(O)C1=O |
| InChI | InChI=1S/C22H32O4/c1-15(2)13-14-17(4)20(23)16(3)11-9-7-8-10-12-19-18(5)21(24)22(6,25)26-19/h7-12,14-16,20,23,25H,13H2,1-6H3/b8-7+,11-9+,12-10+,17-14+/t16-,20-,22?/m1/s1 |
| InChIKey | CEFLFJSAQJIEGR-YWMMPYJMSA-N |
| XLogP | 4.23 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|