C26H45IN4O2 — CID 111643113
1-ethyl-2-[[3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111643113) has the molecular formula C26H45IN4O2 and a molecular weight of 572.58 g/mol. Its IUPAC name is 1-ethyl-2-[[3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111643113 |
| Molecular Formula | C26H45IN4O2 |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | 1-ethyl-2-[[3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(CN2CCC(C)CC2)c1)NCCCOCC1CCOCC1.I |
| InChI | InChI=1S/C26H44N4O2.HI/c1-3-27-26(28-12-5-15-32-21-23-10-16-31-17-11-23)29-19-24-6-4-7-25(18-24)20-30-13-8-22(2)9-14-30;/h4,6-7,18,22-23H,3,5,8-17,19-21H2,1-2H3,(H2,27,28,29);1H |
| InChIKey | GRTZBQBOBFKBME-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|