C18H36F3IN4O2 — CID 111643873
1-ethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111643873) has the molecular formula C18H36F3IN4O2 and a molecular weight of 524.41 g/mol. Its IUPAC name is 1-ethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111643873 |
| Molecular Formula | C18H36F3IN4O2 |
| Molecular Weight | 524.41 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 1-ethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC1CCOCC1)NCCCN(C)CC(F)(F)F.I |
| InChI | InChI=1S/C18H35F3N4O2.HI/c1-3-22-17(23-8-4-10-25(2)15-18(19,20)21)24-9-5-11-27-14-16-6-12-26-13-7-16;/h16H,3-15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | MZVYZHYUNDIIKS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|