About 4-(3-methoxyanilino)-6-N,6-N-dimethylquinoline-3,6-dicarboxamide
4-(3-methoxyanilino)-6-N,6-N-dimethylquinoline-3,6-dicarboxamide (PubChem CID 11164397) has the molecular formula C20H20N4O3
and a molecular weight of 364.41 g/mol. Its IUPAC name is 4-(3-methoxyanilino)-6-N,6-N-dimethylquinoline-3,6-dicarboxamide.
Molecular Properties
| Compound Name | 4-(3-methoxyanilino)-6-N,6-N-dimethylquinoline-3,6-dicarboxamide |
| PubChem CID | 11164397 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 4-(3-methoxyanilino)-6-N,6-N-dimethylquinoline-3,6-dicarboxamide |
| SMILES | COc1cccc(Nc2c(C(N)=O)cnc3ccc(C(=O)N(C)C)cc23)c1 |
| InChI | InChI=1S/C20H20N4O3/c1-24(2)20(26)12-7-8-17-15(9-12)18(16(11-22-17)19(21)25)23-13-5-4-6-14(10-13)27-3/h4-11H,1-3H3,(H2,21,25)(H,22,23) |
| InChIKey | UPRSLNXZNSWEKF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3-methoxyanilino)-6-N,6-N-dimethylquinoline-3,6-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methoxyanilino)-6-N,6-N-dimethylquinoline-3,6-dicarboxamide?
The IUPAC name of 4-(3-methoxyanilino)-6-N,6-N-dimethylquinoline-3,6-dicarboxamide (CID 11164397) is 4-(3-methoxyanilino)-6-N,6-N-dimethylquinoline-3,6-dicarboxamide.
What is the SMILES notation for 4-(3-methoxyanilino)-6-N,6-N-dimethylquinoline-3,6-dicarboxamide?
The canonical SMILES for 4-(3-methoxyanilino)-6-N,6-N-dimethylquinoline-3,6-dicarboxamide is COc1cccc(Nc2c(C(N)=O)cnc3ccc(C(=O)N(C)C)cc23)c1.
What is the InChIKey of 4-(3-methoxyanilino)-6-N,6-N-dimethylquinoline-3,6-dicarboxamide?
The InChIKey is UPRSLNXZNSWEKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4O3/c1-24(2)20(26)12-7-8-17-15(9-12)18(16(11-22-17)19(21)25)23-13-5-4-6-14(10-13)27-3/h4-11H,1-3H3,(H2,21,25)(H,22,23).
What are the key properties of 4-(3-methoxyanilino)-6-N,6-N-dimethylquinoline-3,6-dicarboxamide?
4-(3-methoxyanilino)-6-N,6-N-dimethylquinoline-3,6-dicarboxamide has a molecular weight of 364.41 g/mol, XLogP of 2.79, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methoxyanilino)-6-N,6-N-dimethylquinoline-3,6-dicarboxamide is sourced from PubChem (CID 11164397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).