C18H23NO5S — CID 11164431
(3'aR,5R,7'S,7'aR)-2',2'-dimethyl-7'-phenylmethoxyspiro[1,3-oxazinane-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-thione (PubChem CID 11164431) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is (3'aR,5R,7'S,7'aR)-2',2'-dimethyl-7'-phenylmethoxyspiro[1,3-oxazinane-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-thione.
| Compound Name | (3'aR,5R,7'S,7'aR)-2',2'-dimethyl-7'-phenylmethoxyspiro[1,3-oxazinane-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-thione |
|---|---|
| PubChem CID | 11164431 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (3'aR,5R,7'S,7'aR)-2',2'-dimethyl-7'-phenylmethoxyspiro[1,3-oxazinane-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-thione |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@@]3(CNC(=S)OC3)[C@H]2OCc2ccccc2)O1 |
| InChI | InChI=1S/C18H23NO5S/c1-17(2)23-13-9-22-18(10-19-16(25)21-11-18)15(14(13)24-17)20-8-12-6-4-3-5-7-12/h3-7,13-15H,8-11H2,1-2H3,(H,19,25)/t13-,14-,15+,18-/m1/s1 |
| InChIKey | PJXXAUTYRXTYBI-ZXFNITATSA-N |
| XLogP | 1.77 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|